| Product description : |
Name ： 3-Aminophenol
another names： C.I. 76545; C.I. Oxidation Base 7; 3-Amino-1-hydroxybenzene; m-hydroxyaminobenzene; 3-Hydroxyaniline; m-hydroxyphenylamine; basf ursol bg; fouramine eg; fourrine 65; fourrine eg; furro eg; futramine eg; nako teg; pelagal eg; renal eg; tetral eg; ursol eg; zoba eg; M-Aminophenol; m-amino phenol; Meta Aminophenol
CAS NO： 591-27-5
EINECS NO ： 209-711-2
molecular formula：
C6H7NO
molecular weight： 109.13
InChI： InChI=1/C6H7NO/c7-5-2-1-3-6(8)4-5/h1-4,8H,7H2
Molecular structure ：
Melting point ： 121-124℃
Boiling point ： 164℃ (11 mmHg)
Flash point ： 155℃
Water solubility ： 35 g/L (20℃)
Application ：
Dye and pharmaceutical intermediates, used in the production of anti-tb drugs, the amino acid, stabilizer, developing agent, color film, etc
|
