| Product description : |
Name ： 4-Aminophenol
another names： C.I. 76550; C.I. Oxidation Base 6; 4-Aminophenol; 4-Hydroxyaniline; P-Aminophenol; P-Amino phenol; 4-Amino-1-hydroxybenzene; para aminophenol; Para-aminophenol; 1-amino-4-hydroxybenzene 4-Amino phenol
CAS NO： 123-30-8
EINECS NO： 204-616-2
Molecular formula ： C6H7NO
Molecular weight ： 109.1259
InChI： InChI=1/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2
Molecular structure ：
Density ： 1.21g/cm3
Melting point ： 188℃
Boiling point ： 282°C at 760 mmHg
Lashing point ： 124.3°C
Water solubility ： 1.5 g/100 mL (20℃)
Tension ： 0.00202mmHg at 25°C
Application ：
Used in the production of sulfur blue FBG, weak acid dye, such as light yellow 5 g manufacturing paracetamol, clofibrate, such as drugs, also used for system developer, antioxidant and so on
|
